About 2-ethoxysulfanylphenol
2-ethoxysulfanylphenol (PubChem CID 20674240) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 2-ethoxysulfanylphenol.
Molecular Properties
| Compound Name | 2-ethoxysulfanylphenol |
| PubChem CID | 20674240 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2-ethoxysulfanylphenol |
| SMILES | CCOSc1ccccc1O |
| InChI | InChI=1S/C8H10O2S/c1-2-10-11-8-6-4-3-5-7(8)9/h3-6,9H,2H2,1H3 |
| InChIKey | CGONOWXIUBCPEU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxysulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxysulfanylphenol?
The IUPAC name of 2-ethoxysulfanylphenol (CID 20674240) is 2-ethoxysulfanylphenol.
What is the SMILES notation for 2-ethoxysulfanylphenol?
The canonical SMILES for 2-ethoxysulfanylphenol is CCOSc1ccccc1O.
What is the InChIKey of 2-ethoxysulfanylphenol?
The InChIKey is CGONOWXIUBCPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-2-10-11-8-6-4-3-5-7(8)9/h3-6,9H,2H2,1H3.
What are the key properties of 2-ethoxysulfanylphenol?
2-ethoxysulfanylphenol has a molecular weight of 170.23 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxysulfanylphenol is sourced from PubChem (CID 20674240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).