About ethane;S-(2-hydroxyphenyl) methanethioate;propane
ethane;S-(2-hydroxyphenyl) methanethioate;propane (PubChem CID 143333899) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is ethane;S-(2-hydroxyphenyl) methanethioate;propane.
Molecular Properties
| Compound Name | ethane;S-(2-hydroxyphenyl) methanethioate;propane |
| PubChem CID | 143333899 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | ethane;S-(2-hydroxyphenyl) methanethioate;propane |
| SMILES | CC.CCC.O=CSc1ccccc1O |
| InChI | InChI=1S/C7H6O2S.C3H8.C2H6/c8-5-10-7-4-2-1-3-6(7)9;1-3-2;1-2/h1-5,9H;3H2,1-2H3;1-2H3 |
| InChIKey | DPBPSBAKSPVFOJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;S-(2-hydroxyphenyl) methanethioate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;S-(2-hydroxyphenyl) methanethioate;propane?
The IUPAC name of ethane;S-(2-hydroxyphenyl) methanethioate;propane (CID 143333899) is ethane;S-(2-hydroxyphenyl) methanethioate;propane.
What is the SMILES notation for ethane;S-(2-hydroxyphenyl) methanethioate;propane?
The canonical SMILES for ethane;S-(2-hydroxyphenyl) methanethioate;propane is CC.CCC.O=CSc1ccccc1O.
What is the InChIKey of ethane;S-(2-hydroxyphenyl) methanethioate;propane?
The InChIKey is DPBPSBAKSPVFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2S.C3H8.C2H6/c8-5-10-7-4-2-1-3-6(7)9;1-3-2;1-2/h1-5,9H;3H2,1-2H3;1-2H3.
What are the key properties of ethane;S-(2-hydroxyphenyl) methanethioate;propane?
ethane;S-(2-hydroxyphenyl) methanethioate;propane has a molecular weight of 228.36 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;S-(2-hydroxyphenyl) methanethioate;propane is sourced from PubChem (CID 143333899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).