C11H12O4S — CID 117120225
1-(4-methoxy-1,1-dioxo-1-benzothiophen-2-yl)ethanol (PubChem CID 117120225) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-(4-methoxy-1,1-dioxo-1-benzothiophen-2-yl)ethanol.
| Compound Name | 1-(4-methoxy-1,1-dioxo-1-benzothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 117120225 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-(4-methoxy-1,1-dioxo-1-benzothiophen-2-yl)ethanol |
| SMILES | COc1cccc2c1C=C(C(C)O)S2(=O)=O |
| InChI | InChI=1S/C11H12O4S/c1-7(12)11-6-8-9(15-2)4-3-5-10(8)16(11,13)14/h3-7,12H,1-2H3 |
| InChIKey | GCAWVAJKFNJLET-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |