C20H21NO4S — CID 10959674
ethyl 2-deuterio-2-[(10,10-dioxothioxanthen-9-ylidene)amino]-3-methylbutanoate (PubChem CID 10959674) has the molecular formula C20H21NO4S and a molecular weight of 372.46 g/mol. Its IUPAC name is ethyl 2-deuterio-2-[(10,10-dioxothioxanthen-9-ylidene)amino]-3-methylbutanoate.
| Compound Name | ethyl 2-deuterio-2-[(10,10-dioxothioxanthen-9-ylidene)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10959674 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | ethyl 2-deuterio-2-[(10,10-dioxothioxanthen-9-ylidene)amino]-3-methylbutanoate |
| SMILES | [2H]C(N=C1c2ccccc2S(=O)(=O)c2ccccc21)(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C20H21NO4S/c1-4-25-20(22)18(13(2)3)21-19-14-9-5-7-11-16(14)26(23,24)17-12-8-6-10-15(17)19/h5-13,18H,4H2,1-3H3/i18D |
| InChIKey | NNJFPRLQGNNHTA-VAAKKRCDSA-N |
| XLogP | 3.26 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|