C12H8O4S — CID 54317677
5,5-dioxodibenzothiophene-3,4-diol (PubChem CID 54317677) has the molecular formula C12H8O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 5,5-dioxodibenzothiophene-3,4-diol.
| Compound Name | 5,5-dioxodibenzothiophene-3,4-diol |
|---|---|
| PubChem CID | 54317677 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 5,5-dioxodibenzothiophene-3,4-diol |
| SMILES | O=S1(=O)c2ccccc2-c2ccc(O)c(O)c21 |
| InChI | InChI=1S/C12H8O4S/c13-9-6-5-8-7-3-1-2-4-10(7)17(15,16)12(8)11(9)14/h1-6,13-14H |
| InChIKey | SPJUEJWWCFHAHQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|