C30H19NO4S2 — CID 145125649
10-[2-(5,5-dioxodibenzothiophen-4-yl)phenyl]phenothiazine 5,5-dioxide (PubChem CID 145125649) has the molecular formula C30H19NO4S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is 10-[2-(5,5-dioxodibenzothiophen-4-yl)phenyl]phenothiazine 5,5-dioxide.
| Compound Name | 10-[2-(5,5-dioxodibenzothiophen-4-yl)phenyl]phenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 145125649 |
| Molecular Formula | C30H19NO4S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 10-[2-(5,5-dioxodibenzothiophen-4-yl)phenyl]phenothiazine 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2N(c2ccccc2-c2cccc3c2S(=O)(=O)c2ccccc2-3)c2ccccc21 |
| InChI | InChI=1S/C30H19NO4S2/c32-36(33)28-18-7-4-15-25(28)31(26-16-5-8-19-29(26)36)24-14-3-1-10-20(24)22-12-9-13-23-21-11-2-6-17-27(21)37(34,35)30(22)23/h1-19H |
| InChIKey | SJRQQJXNFPNXHF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |