C16H10O2S — CID 13360927
naphtho[1,2-b][1]benzothiole 11,11-dioxide (PubChem CID 13360927) has the molecular formula C16H10O2S and a molecular weight of 266.32 g/mol. Its IUPAC name is naphtho[1,2-b][1]benzothiole 11,11-dioxide.
| Compound Name | naphtho[1,2-b][1]benzothiole 11,11-dioxide |
|---|---|
| PubChem CID | 13360927 |
| Molecular Formula | C16H10O2S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | naphtho[1,2-b][1]benzothiole 11,11-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2ccc3ccccc3c21 |
| InChI | InChI=1S/C16H10O2S/c17-19(18)15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)19/h1-10H |
| InChIKey | IZZOHYVSZLMGAK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |