C15H16O2SSi — CID 165347293
(5,5-dioxodibenzothiophen-4-yl)-trimethylsilane (PubChem CID 165347293) has the molecular formula C15H16O2SSi and a molecular weight of 288.44 g/mol. Its IUPAC name is (5,5-dioxodibenzothiophen-4-yl)-trimethylsilane.
| Compound Name | (5,5-dioxodibenzothiophen-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 165347293 |
| Molecular Formula | C15H16O2SSi |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (5,5-dioxodibenzothiophen-4-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc2c1S(=O)(=O)c1ccccc1-2 |
| InChI | InChI=1S/C15H16O2SSi/c1-19(2,3)14-10-6-8-12-11-7-4-5-9-13(11)18(16,17)15(12)14/h4-10H,1-3H3 |
| InChIKey | PVAUKDNHHJNKHR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|