C20H19NO2SSi — CID 140719581
[2-(5,5-dioxodibenzothiophen-2-yl)-4-pyridinyl]-trimethylsilane (PubChem CID 140719581) has the molecular formula C20H19NO2SSi and a molecular weight of 365.53 g/mol. Its IUPAC name is [2-(5,5-dioxodibenzothiophen-2-yl)-4-pyridinyl]-trimethylsilane.
| Compound Name | [2-(5,5-dioxodibenzothiophen-2-yl)-4-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140719581 |
| Molecular Formula | C20H19NO2SSi |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [2-(5,5-dioxodibenzothiophen-2-yl)-4-pyridinyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccnc(-c2ccc3c(c2)-c2ccccc2S3(=O)=O)c1 |
| InChI | InChI=1S/C20H19NO2SSi/c1-25(2,3)15-10-11-21-18(13-15)14-8-9-20-17(12-14)16-6-4-5-7-19(16)24(20,22)23/h4-13H,1-3H3 |
| InChIKey | ISMBPVRIKCUSSK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|