C25H21NO2SSi — CID 140720125
[6-(5,5-dioxodibenzothiophen-3-yl)-3-pyridinyl]-dimethyl-phenylsilane (PubChem CID 140720125) has the molecular formula C25H21NO2SSi and a molecular weight of 427.60 g/mol. Its IUPAC name is [6-(5,5-dioxodibenzothiophen-3-yl)-3-pyridinyl]-dimethyl-phenylsilane.
| Compound Name | [6-(5,5-dioxodibenzothiophen-3-yl)-3-pyridinyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 140720125 |
| Molecular Formula | C25H21NO2SSi |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [6-(5,5-dioxodibenzothiophen-3-yl)-3-pyridinyl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)c1ccc(-c2ccc3c(c2)S(=O)(=O)c2ccccc2-3)nc1 |
| InChI | InChI=1S/C25H21NO2SSi/c1-30(2,19-8-4-3-5-9-19)20-13-15-23(26-17-20)18-12-14-22-21-10-6-7-11-24(21)29(27,28)25(22)16-18/h3-17H,1-2H3 |
| InChIKey | CNDWWSLVEVSAJM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|