C25H22N2OSi — CID 140720059
dimethyl-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]-phenylsilane (PubChem CID 140720059) has the molecular formula C25H22N2OSi and a molecular weight of 394.55 g/mol. Its IUPAC name is dimethyl-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]-phenylsilane.
| Compound Name | dimethyl-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]-phenylsilane |
|---|---|
| PubChem CID | 140720059 |
| Molecular Formula | C25H22N2OSi |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | dimethyl-[6-(2-methyl-[1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]-phenylsilane |
| SMILES | Cc1ccc2c(n1)oc1ccc(-c3ccc([Si](C)(C)c4ccccc4)cn3)cc12 |
| InChI | InChI=1S/C25H22N2OSi/c1-17-9-12-21-22-15-18(10-14-24(22)28-25(21)27-17)23-13-11-20(16-26-23)29(2,3)19-7-5-4-6-8-19/h4-16H,1-3H3 |
| InChIKey | BFAVLZPHSOGUJT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|