C35H28N2OSi — CID 169294079
[4-[7-[6-([1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]naphthalen-2-yl]phenyl]-trimethylsilane (PubChem CID 169294079) has the molecular formula C35H28N2OSi and a molecular weight of 520.71 g/mol. Its IUPAC name is [4-[7-[6-([1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]naphthalen-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[7-[6-([1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]naphthalen-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 169294079 |
| Molecular Formula | C35H28N2OSi |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [4-[7-[6-([1]benzofuro[2,3-b]pyridin-6-yl)-3-pyridinyl]naphthalen-2-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc3ccc(-c4ccc(-c5ccc6oc7ncccc7c6c5)nc4)cc3c2)cc1 |
| InChI | InChI=1S/C35H28N2OSi/c1-39(2,3)30-14-10-23(11-15-30)25-8-6-24-7-9-26(20-29(24)19-25)28-12-16-33(37-22-28)27-13-17-34-32(21-27)31-5-4-18-36-35(31)38-34/h4-22H,1-3H3 |
| InChIKey | XNLUGANWUOYADO-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|