C31H33NOSi — CID 162709398
trimethyl-[6-[7-(3-phenylpentan-3-yl)dibenzofuran-2-yl]-3-pyridinyl]silane (PubChem CID 162709398) has the molecular formula C31H33NOSi and a molecular weight of 463.70 g/mol. Its IUPAC name is trimethyl-[6-[7-(3-phenylpentan-3-yl)dibenzofuran-2-yl]-3-pyridinyl]silane.
| Compound Name | trimethyl-[6-[7-(3-phenylpentan-3-yl)dibenzofuran-2-yl]-3-pyridinyl]silane |
|---|---|
| PubChem CID | 162709398 |
| Molecular Formula | C31H33NOSi |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | trimethyl-[6-[7-(3-phenylpentan-3-yl)dibenzofuran-2-yl]-3-pyridinyl]silane |
| SMILES | CCC(CC)(c1ccccc1)c1ccc2c(c1)oc1ccc(-c3ccc([Si](C)(C)C)cn3)cc12 |
| InChI | InChI=1S/C31H33NOSi/c1-6-31(7-2,23-11-9-8-10-12-23)24-14-16-26-27-19-22(13-18-29(27)33-30(26)20-24)28-17-15-25(21-32-28)34(3,4)5/h8-21H,6-7H2,1-5H3 |
| InChIKey | NIPSVZYJJWYUEY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|