C30H32N2OSi — CID 140719967
[6-(1,3-dimethyl-[1]benzofuro[2,3-c]pyridin-6-yl)-4-(2-methylpropyl)-3-pyridinyl]-dimethyl-phenylsilane (PubChem CID 140719967) has the molecular formula C30H32N2OSi and a molecular weight of 464.69 g/mol. Its IUPAC name is [6-(1,3-dimethyl-[1]benzofuro[2,3-c]pyridin-6-yl)-4-(2-methylpropyl)-3-pyridinyl]-dimethyl-phenylsilane.
| Compound Name | [6-(1,3-dimethyl-[1]benzofuro[2,3-c]pyridin-6-yl)-4-(2-methylpropyl)-3-pyridinyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 140719967 |
| Molecular Formula | C30H32N2OSi |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [6-(1,3-dimethyl-[1]benzofuro[2,3-c]pyridin-6-yl)-4-(2-methylpropyl)-3-pyridinyl]-dimethyl-phenylsilane |
| SMILES | Cc1cc2c(oc3ccc(-c4cc(CC(C)C)c([Si](C)(C)c5ccccc5)cn4)cc32)c(C)n1 |
| InChI | InChI=1S/C30H32N2OSi/c1-19(2)14-23-17-27(31-18-29(23)34(5,6)24-10-8-7-9-11-24)22-12-13-28-25(16-22)26-15-20(3)32-21(4)30(26)33-28/h7-13,15-19H,14H2,1-6H3 |
| InChIKey | PVBQBBOJCSZBAN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|