C27H27NSi2 — CID 140719829
[6-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)-3-pyridinyl]-dimethyl-phenylsilane (PubChem CID 140719829) has the molecular formula C27H27NSi2 and a molecular weight of 421.69 g/mol. Its IUPAC name is [6-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)-3-pyridinyl]-dimethyl-phenylsilane.
| Compound Name | [6-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)-3-pyridinyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 140719829 |
| Molecular Formula | C27H27NSi2 |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [6-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)-3-pyridinyl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)c1ccc(-c2cccc3c2[Si](C)(C)c2ccccc2-3)nc1 |
| InChI | InChI=1S/C27H27NSi2/c1-29(2,20-11-6-5-7-12-20)21-17-18-25(28-19-21)24-15-10-14-23-22-13-8-9-16-26(22)30(3,4)27(23)24/h5-19H,1-4H3 |
| InChIKey | MQMBVJIOKXRGDH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|