C19H19NSi — CID 140737904
dimethyl-phenyl-[6-(2,3,4,5-tetradeuteriophenyl)-3-pyridinyl]silane (PubChem CID 140737904) has the molecular formula C19H19NSi and a molecular weight of 293.48 g/mol. Its IUPAC name is dimethyl-phenyl-[6-(2,3,4,5-tetradeuteriophenyl)-3-pyridinyl]silane.
| Compound Name | dimethyl-phenyl-[6-(2,3,4,5-tetradeuteriophenyl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 140737904 |
| Molecular Formula | C19H19NSi |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | dimethyl-phenyl-[6-(2,3,4,5-tetradeuteriophenyl)-3-pyridinyl]silane |
| SMILES | [2H]c1cc(-c2ccc([Si](C)(C)c3ccccc3)cn2)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C19H19NSi/c1-21(2,17-11-7-4-8-12-17)18-13-14-19(20-15-18)16-9-5-3-6-10-16/h3-15H,1-2H3/i3D,5D,6D,9D |
| InChIKey | YOHBHNCNJXCTJG-FZWVDBJPSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|