C14H16FNSi — CID 169300605
trimethyl-[6-(2,3,5-trideuterio-4-fluorophenyl)-3-pyridinyl]silane (PubChem CID 169300605) has the molecular formula C14H16FNSi and a molecular weight of 248.39 g/mol. Its IUPAC name is trimethyl-[6-(2,3,5-trideuterio-4-fluorophenyl)-3-pyridinyl]silane.
| Compound Name | trimethyl-[6-(2,3,5-trideuterio-4-fluorophenyl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 169300605 |
| Molecular Formula | C14H16FNSi |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | trimethyl-[6-(2,3,5-trideuterio-4-fluorophenyl)-3-pyridinyl]silane |
| SMILES | [2H]c1cc(-c2ccc([Si](C)(C)C)cn2)c([2H])c([2H])c1F |
| InChI | InChI=1S/C14H16FNSi/c1-17(2,3)13-8-9-14(16-10-13)11-4-6-12(15)7-5-11/h4-10H,1-3H3/i4D,6D,7D |
| InChIKey | RSWWNCIJYCMNEH-FIGIXCGVSA-N |
| XLogP | 3.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|