C15H16F3NSi — CID 169052729
dimethyl-(6-phenyl-3-pyridinyl)-(2,2,2-trifluoroethyl)silane (PubChem CID 169052729) has the molecular formula C15H16F3NSi and a molecular weight of 295.38 g/mol. Its IUPAC name is dimethyl-(6-phenyl-3-pyridinyl)-(2,2,2-trifluoroethyl)silane.
| Compound Name | dimethyl-(6-phenyl-3-pyridinyl)-(2,2,2-trifluoroethyl)silane |
|---|---|
| PubChem CID | 169052729 |
| Molecular Formula | C15H16F3NSi |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | dimethyl-(6-phenyl-3-pyridinyl)-(2,2,2-trifluoroethyl)silane |
| SMILES | C[Si](C)(CC(F)(F)F)c1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C15H16F3NSi/c1-20(2,11-15(16,17)18)13-8-9-14(19-10-13)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3 |
| InChIKey | CJXWAMRMCJEVAT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|