C11H9N — CID 59070802
2,3,4,5-tetradeuterio-6-(2,3,4,5-tetradeuteriophenyl)pyridine (PubChem CID 59070802) has the molecular formula C11H9N and a molecular weight of 163.25 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-(2,3,4,5-tetradeuteriophenyl)pyridine.
| Compound Name | 2,3,4,5-tetradeuterio-6-(2,3,4,5-tetradeuteriophenyl)pyridine |
|---|---|
| PubChem CID | 59070802 |
| Molecular Formula | C11H9N |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-(2,3,4,5-tetradeuteriophenyl)pyridine |
| SMILES | [2H]c1cc(-c2nc([2H])c([2H])c([2H])c2[2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C11H9N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-9H/i1D,2D,3D,4D,5D,6D,8D,9D |
| InChIKey | VQGHOUODWALEFC-OAIDQEKXSA-N |
| XLogP | 2.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |