C15H15N — CID 140711681
3-(2,3,4,5-tetradeuteriophenyl)-5,6,7,8-tetrahydroisoquinoline (PubChem CID 140711681) has the molecular formula C15H15N and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(2,3,4,5-tetradeuteriophenyl)-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 3-(2,3,4,5-tetradeuteriophenyl)-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 140711681 |
| Molecular Formula | C15H15N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-(2,3,4,5-tetradeuteriophenyl)-5,6,7,8-tetrahydroisoquinoline |
| SMILES | [2H]c1cc(-c2cc3c(cn2)CCCC3)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C15H15N/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-16-15/h1-3,6-7,10-11H,4-5,8-9H2/i1D,2D,3D,6D |
| InChIKey | XRNQWXNSPVCGTC-VTBMLFEUSA-N |
| XLogP | 3.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |