C10H11I — CID 11184504
5-deuterio-7-iodo-1,2,3,4-tetrahydronaphthalene (PubChem CID 11184504) has the molecular formula C10H11I and a molecular weight of 259.11 g/mol. Its IUPAC name is 5-deuterio-7-iodo-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-deuterio-7-iodo-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 11184504 |
| Molecular Formula | C10H11I |
| Molecular Weight | 259.11 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 5-deuterio-7-iodo-1,2,3,4-tetrahydronaphthalene |
| SMILES | [2H]c1cc(I)cc2c1CCCC2 |
| InChI | InChI=1S/C10H11I/c11-10-6-5-8-3-1-2-4-9(8)7-10/h5-7H,1-4H2/i5D |
| InChIKey | UPGOXMUQOUACMG-UICOGKGYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|