C29H19N3 — CID 172553681
2-[4-anthracen-9-yl-3,5-dideuterio-6-(3,4,5-trideuterio-2-pyridinyl)-2-pyridinyl]-3,4,5,6-tetradeuteriopyridine (PubChem CID 172553681) has the molecular formula C29H19N3 and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-[4-anthracen-9-yl-3,5-dideuterio-6-(3,4,5-trideuterio-2-pyridinyl)-2-pyridinyl]-3,4,5,6-tetradeuteriopyridine.
| Compound Name | 2-[4-anthracen-9-yl-3,5-dideuterio-6-(3,4,5-trideuterio-2-pyridinyl)-2-pyridinyl]-3,4,5,6-tetradeuteriopyridine |
|---|---|
| PubChem CID | 172553681 |
| Molecular Formula | C29H19N3 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-[4-anthracen-9-yl-3,5-dideuterio-6-(3,4,5-trideuterio-2-pyridinyl)-2-pyridinyl]-3,4,5,6-tetradeuteriopyridine |
| SMILES | [2H]c1cnc(-c2nc(-c3nc([2H])c([2H])c([2H])c3[2H])c([2H])c(-c3c4ccccc4cc4ccccc34)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C29H19N3/c1-3-11-23-20(9-1)17-21-10-2-4-12-24(21)29(23)22-18-27(25-13-5-7-15-30-25)32-28(19-22)26-14-6-8-16-31-26/h1-19H/i5D,6D,7D,8D,13D,14D,15D,18D,19D |
| InChIKey | SBJMNAHBRGPXQA-QRCVSNHQSA-N |
| XLogP | 7.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|