C28H18 — CID 155650649
1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenanthren-3-ylanthracene (PubChem CID 155650649) has the molecular formula C28H18 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenanthren-3-ylanthracene.
| Compound Name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenanthren-3-ylanthracene |
|---|---|
| PubChem CID | 155650649 |
| Molecular Formula | C28H18 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenanthren-3-ylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccc5ccccc5c4c3)c3c([2H])c([2H])c([2H])c([2H])c3c([2H])c2c1[2H] |
| InChI | InChI=1S/C28H18/c1-4-10-24-19(7-1)13-14-20-15-16-23(18-27(20)24)28-25-11-5-2-8-21(25)17-22-9-3-6-12-26(22)28/h1-18H/i2D,3D,5D,6D,8D,9D,11D,12D,17D |
| InChIKey | SCNBZWFFVGFRTK-XVBCYZGOSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|