C20H14 — CID 153473515
1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenylanthracene (PubChem CID 153473515) has the molecular formula C20H14 and a molecular weight of 263.39 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenylanthracene.
| Compound Name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenylanthracene |
|---|---|
| PubChem CID | 153473515 |
| Molecular Formula | C20H14 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-phenylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccccc3)c3c([2H])c([2H])c([2H])c([2H])c3c([2H])c2c1[2H] |
| InChI | InChI=1S/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H/i4D,5D,6D,7D,10D,11D,12D,13D,14D |
| InChIKey | LUBXLGUQZVKOFP-FKPZTAQHSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|