C20H13Br — CID 153436434
9-bromo-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene (PubChem CID 153436434) has the molecular formula C20H13Br and a molecular weight of 341.28 g/mol. Its IUPAC name is 9-bromo-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene.
| Compound Name | 9-bromo-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene |
|---|---|
| PubChem CID | 153436434 |
| Molecular Formula | C20H13Br |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 9-bromo-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccccc3)c3c([2H])c([2H])c([2H])c([2H])c3c(Br)c2c1[2H] |
| InChI | InChI=1S/C20H13Br/c21-20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h1-13H/i4D,5D,6D,7D,10D,11D,12D,13D |
| InChIKey | WHGGVVHVBFMGSG-YIMBMRFBSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|