C48H34BBrO2 — CID 158325339
9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene;naphthalen-2-ylboronic acid;1,2,3,4,5,6,7,8,9-nonadeuterio-10-naphthalen-2-ylanthracene (PubChem CID 158325339) has the molecular formula C48H34BBrO2 and a molecular weight of 751.62 g/mol. Its IUPAC name is 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene;naphthalen-2-ylboronic acid;1,2,3,4,5,6,7,8,9-nonadeuterio-10-naphthalen-2-ylanthracene.
| Compound Name | 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene;naphthalen-2-ylboronic acid;1,2,3,4,5,6,7,8,9-nonadeuterio-10-naphthalen-2-ylanthracene |
|---|---|
| PubChem CID | 158325339 |
| Molecular Formula | C48H34BBrO2 |
| Molecular Weight | 751.62 g/mol |
| Exact Mass | 750.30 |
| IUPAC Name | 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene;naphthalen-2-ylboronic acid;1,2,3,4,5,6,7,8,9-nonadeuterio-10-naphthalen-2-ylanthracene |
| SMILES | OB(O)c1ccc2ccccc2c1.[2H]c1c([2H])c([2H])c2c(-c3ccc4ccccc4c3)c3c([2H])c([2H])c([2H])c([2H])c3c([2H])c2c1[2H].[2H]c1c([2H])c([2H])c2c(Br)c3c([2H])c([2H])c([2H])c([2H])c3c([2H])c2c1[2H] |
| InChI | InChI=1S/C24H16.C14H9Br.C10H9BO2/c1-2-8-18-15-21(14-13-17(18)7-1)24-22-11-5-3-9-19(22)16-20-10-4-6-12-23(20)24;15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-16H;1-9H;1-7,12-13H/i3D,4D,5D,6D,9D,10D,11D,12D,16D;1D,2D,3D,4D,5D,6D,7D,8D,9D; |
| InChIKey | GPIJPAMQYLMOLS-YPZHJNCBSA-N |
| XLogP | 12.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.62 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|