C16H13BO2 — CID 170691102
[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]boronic acid (PubChem CID 170691102) has the molecular formula C16H13BO2 and a molecular weight of 253.12 g/mol. Its IUPAC name is [6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]boronic acid.
| Compound Name | [6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]boronic acid |
|---|---|
| PubChem CID | 170691102 |
| Molecular Formula | C16H13BO2 |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]boronic acid |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3cc(B(O)O)ccc3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C16H13BO2/c18-17(19)16-9-8-14-10-13(6-7-15(14)11-16)12-4-2-1-3-5-12/h1-11,18-19H/i1D,2D,3D,4D,5D |
| InChIKey | XDKCHGWZDWHBQO-RALIUCGRSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|