C14H10 — CID 141245639
1,2,3,4-tetradeuterioanthracene (PubChem CID 141245639) has the molecular formula C14H10 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterioanthracene.
| Compound Name | 1,2,3,4-tetradeuterioanthracene |
|---|---|
| PubChem CID | 141245639 |
| Molecular Formula | C14H10 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 1,2,3,4-tetradeuterioanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2cc3ccccc3cc2c1[2H] |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,5D,6D |
| InChIKey | MWPLVEDNUUSJAV-NMRLXUNGSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|