About anthracene;ozone
anthracene;ozone (PubChem CID 159778509) has the molecular formula C14H10O3
and a molecular weight of 226.23 g/mol. Its IUPAC name is anthracene;ozone.
Molecular Properties
| Compound Name | anthracene;ozone |
| PubChem CID | 159778509 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | anthracene;ozone |
| SMILES | O=[O+][O-].c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.O3/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-2/h1-10H; |
| InChIKey | NHAZFMLHTPYYEW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;ozone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;ozone?
The IUPAC name of anthracene;ozone (CID 159778509) is anthracene;ozone.
What is the SMILES notation for anthracene;ozone?
The canonical SMILES for anthracene;ozone is O=[O+][O-].c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;ozone?
The InChIKey is NHAZFMLHTPYYEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.O3/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-2/h1-10H;.
What are the key properties of anthracene;ozone?
anthracene;ozone has a molecular weight of 226.23 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;ozone is sourced from PubChem (CID 159778509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).