C34H20 — CID 177071935
12-(1,3,4,5,6,7,8,9,10-nonadeuteriopyren-2-yl)benzo[a]anthracene (PubChem CID 177071935) has the molecular formula C34H20 and a molecular weight of 437.59 g/mol. Its IUPAC name is 12-(1,3,4,5,6,7,8,9,10-nonadeuteriopyren-2-yl)benzo[a]anthracene.
| Compound Name | 12-(1,3,4,5,6,7,8,9,10-nonadeuteriopyren-2-yl)benzo[a]anthracene |
|---|---|
| PubChem CID | 177071935 |
| Molecular Formula | C34H20 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 12-(1,3,4,5,6,7,8,9,10-nonadeuteriopyren-2-yl)benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c([2H])c(-c4c5ccccc5cc5ccc6ccccc6c45)c([2H])c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C34H20/c1-3-10-29-21(6-1)12-15-27-18-24-7-2-4-11-30(24)34(33(27)29)28-19-25-16-13-22-8-5-9-23-14-17-26(20-28)32(25)31(22)23/h1-20H/i5D,8D,9D,13D,14D,16D,17D,19D,20D |
| InChIKey | HHZYQUMPFDSNMD-MJABLGDESA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|