C42H26 — CID 177071891
5-(4-benzo[a]anthracen-5-yl-2,3,5,6-tetradeuteriophenyl)benzo[c]phenanthrene (PubChem CID 177071891) has the molecular formula C42H26 and a molecular weight of 534.69 g/mol. Its IUPAC name is 5-(4-benzo[a]anthracen-5-yl-2,3,5,6-tetradeuteriophenyl)benzo[c]phenanthrene.
| Compound Name | 5-(4-benzo[a]anthracen-5-yl-2,3,5,6-tetradeuteriophenyl)benzo[c]phenanthrene |
|---|---|
| PubChem CID | 177071891 |
| Molecular Formula | C42H26 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 5-(4-benzo[a]anthracen-5-yl-2,3,5,6-tetradeuteriophenyl)benzo[c]phenanthrene |
| SMILES | [2H]c1c([2H])c(-c2cc3ccc4ccccc4c3c3ccccc23)c([2H])c([2H])c1-c1cc2cc3ccccc3cc2c2ccccc12 |
| InChI | InChI=1S/C42H26/c1-2-11-31-24-41-33(23-30(31)10-1)26-40(35-13-5-6-14-36(35)41)29-19-17-28(18-20-29)39-25-32-22-21-27-9-3-4-12-34(27)42(32)38-16-8-7-15-37(38)39/h1-26H/i17D,18D,19D,20D |
| InChIKey | DYFJNGOMXDRDGL-RACFJZOYSA-N |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|