C40H24O — CID 171045901
12-benzo[a]anthracen-12-yl-5-(2,3,4,5,6-pentadeuteriophenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene (PubChem CID 171045901) has the molecular formula C40H24O and a molecular weight of 525.66 g/mol. Its IUPAC name is 12-benzo[a]anthracen-12-yl-5-(2,3,4,5,6-pentadeuteriophenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene.
| Compound Name | 12-benzo[a]anthracen-12-yl-5-(2,3,4,5,6-pentadeuteriophenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 171045901 |
| Molecular Formula | C40H24O |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 12-benzo[a]anthracen-12-yl-5-(2,3,4,5,6-pentadeuteriophenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)Oc2ccc(-c4c5ccccc5cc5ccc6ccccc6c45)c4cccc-3c24)c([2H])c1[2H] |
| InChI | InChI=1S/C40H24O/c1-2-9-25(10-3-1)27-19-20-32-33-15-8-16-34-35(21-22-36(39(33)34)41-37(32)24-27)40-31-14-7-5-12-28(31)23-29-18-17-26-11-4-6-13-30(26)38(29)40/h1-24H/i1D,2D,3D,9D,10D |
| InChIKey | OKJOHUBJAYCPDQ-MYWHSQMISA-N |
| XLogP | 11.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|