C44H26O — CID 171044868
16-[12-(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracen-8-yl]-12-oxapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene (PubChem CID 171044868) has the molecular formula C44H26O and a molecular weight of 575.72 g/mol. Its IUPAC name is 16-[12-(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracen-8-yl]-12-oxapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene.
| Compound Name | 16-[12-(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracen-8-yl]-12-oxapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 171044868 |
| Molecular Formula | C44H26O |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 16-[12-(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracen-8-yl]-12-oxapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3cccc(-c4ccc5c6c(cccc46)-c4ccc6ccccc6c4O5)c3cc3ccc4ccccc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H26O/c1-2-12-29(13-3-1)41-37-19-8-16-33(39(37)26-30-21-20-27-10-4-6-14-31(27)42(30)41)34-24-25-40-43-35(34)17-9-18-36(43)38-23-22-28-11-5-7-15-32(28)44(38)45-40/h1-26H/i1D,2D,3D,12D,13D |
| InChIKey | BRWKQPGHRAZFRJ-AYAICNHJSA-N |
| XLogP | 12.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|