C40H24 — CID 177078621
12-(2,3,4,7,8,9,10-heptadeuterio-6-phenylpyren-1-yl)benzo[a]anthracene (PubChem CID 177078621) has the molecular formula C40H24 and a molecular weight of 511.67 g/mol. Its IUPAC name is 12-(2,3,4,7,8,9,10-heptadeuterio-6-phenylpyren-1-yl)benzo[a]anthracene.
| Compound Name | 12-(2,3,4,7,8,9,10-heptadeuterio-6-phenylpyren-1-yl)benzo[a]anthracene |
|---|---|
| PubChem CID | 177078621 |
| Molecular Formula | C40H24 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 12-(2,3,4,7,8,9,10-heptadeuterio-6-phenylpyren-1-yl)benzo[a]anthracene |
| SMILES | [2H]c1c(-c2ccccc2)c2cc([2H])c3c([2H])c([2H])c(-c4c5ccccc5cc5ccc6ccccc6c45)c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C40H24/c1-2-8-25(9-3-1)31-20-16-27-18-22-35-36(23-19-28-17-21-34(31)37(27)38(28)35)40-33-13-7-5-11-29(33)24-30-15-14-26-10-4-6-12-32(26)39(30)40/h1-24H/i16D,17D,18D,19D,20D,22D,23D |
| InChIKey | RDRWHQQBHPKODI-HUBRIOTESA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|