C44H26 — CID 166019858
1,2,3,4,5,6,7,9,10-nonadeuterio-8-[3-[4-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]phenyl]pyrene (PubChem CID 166019858) has the molecular formula C44H26 and a molecular weight of 572.80 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,9,10-nonadeuterio-8-[3-[4-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]phenyl]pyrene.
| Compound Name | 1,2,3,4,5,6,7,9,10-nonadeuterio-8-[3-[4-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]phenyl]pyrene |
|---|---|
| PubChem CID | 166019858 |
| Molecular Formula | C44H26 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | 1,2,3,4,5,6,7,9,10-nonadeuterio-8-[3-[4-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]phenyl]pyrene |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c([2H])c([2H])c(-c4ccc(-c5cccc(-c6c([2H])c([2H])c7c([2H])c([2H])c8c([2H])c([2H])c([2H])c9c([2H])c([2H])c6c7c89)c5)cc4)c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C44H26/c1-4-29-14-16-33-18-22-37(39-24-20-31(6-1)41(29)43(33)39)28-12-10-27(11-13-28)35-8-3-9-36(26-35)38-23-19-34-17-15-30-5-2-7-32-21-25-40(38)44(34)42(30)32/h1-26H/i1D,2D,4D,5D,6D,7D,14D,15D,16D,17D,18D,19D,20D,21D,22D,23D,24D,25D |
| InChIKey | LOQKTKRYGGZVPW-GWMOJARBSA-N |
| XLogP | 12.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|