C38H23BO2 — CID 156890422
[2,4,6-trideuterio-3,5-bis(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]boronic acid (PubChem CID 156890422) has the molecular formula C38H23BO2 and a molecular weight of 543.54 g/mol. Its IUPAC name is [2,4,6-trideuterio-3,5-bis(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]boronic acid.
| Compound Name | [2,4,6-trideuterio-3,5-bis(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 156890422 |
| Molecular Formula | C38H23BO2 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | [2,4,6-trideuterio-3,5-bis(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]boronic acid |
| SMILES | [2H]c1c(B(O)O)c([2H])c(-c2c([2H])c([2H])c3c([2H])c([2H])c4c([2H])c([2H])c([2H])c5c([2H])c([2H])c2c3c45)c([2H])c1-c1c([2H])c([2H])c2c([2H])c([2H])c3c([2H])c([2H])c([2H])c4c([2H])c([2H])c1c2c34 |
| InChI | InChI=1S/C38H23BO2/c40-39(41)30-20-28(31-15-11-26-9-7-22-3-1-5-24-13-17-33(31)37(26)35(22)24)19-29(21-30)32-16-12-27-10-8-23-4-2-6-25-14-18-34(32)38(27)36(23)25/h1-21,40-41H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D,21D |
| InChIKey | CUEFDSGCXNGFNK-DWNMPCLQSA-N |
| XLogP | 8.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|