C16H10O — CID 12986428
2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-ol (PubChem CID 12986428) has the molecular formula C16H10O and a molecular weight of 227.31 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-ol.
| Compound Name | 2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-ol |
|---|---|
| PubChem CID | 12986428 |
| Molecular Formula | C16H10O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-ol |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c([2H])c([2H])c(O)c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| InChIKey | BIJNHUAPTJVVNQ-LOIXRAQWSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|