C14H10O — CID 71751562
1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol (PubChem CID 71751562) has the molecular formula C14H10O and a molecular weight of 203.29 g/mol. Its IUPAC name is 1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol.
| Compound Name | 1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol |
|---|---|
| PubChem CID | 71751562 |
| Molecular Formula | C14H10O |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c([2H])c(O)c([2H])c([2H])c12 |
| InChI | InChI=1S/C14H10O/c15-12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14/h1-9,15H/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| InChIKey | YPWLZGITFNGGKW-LOIXRAQWSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|