C13H9N — CID 15555077
1,2,3,5,6,7,8,9,10-nonadeuteriobenzo[f]quinoline (PubChem CID 15555077) has the molecular formula C13H9N and a molecular weight of 188.28 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,9,10-nonadeuteriobenzo[f]quinoline.
| Compound Name | 1,2,3,5,6,7,8,9,10-nonadeuteriobenzo[f]quinoline |
|---|---|
| PubChem CID | 15555077 |
| Molecular Formula | C13H9N |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1,2,3,5,6,7,8,9,10-nonadeuteriobenzo[f]quinoline |
| SMILES | [2H]c1nc2c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c3c2c([2H])c1[2H] |
| InChI | InChI=1S/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| InChIKey | HCAUQPZEWLULFJ-LOIXRAQWSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|