C12H8N2 — CID 166509195
2,3,4,5,6,7,8-heptadeuterio-1,10-phenanthroline (PubChem CID 166509195) has the molecular formula C12H8N2 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-1,10-phenanthroline.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-1,10-phenanthroline |
|---|---|
| PubChem CID | 166509195 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-1,10-phenanthroline |
| SMILES | [2H]c1cnc2c(c1[2H])c([2H])c([2H])c1c([2H])c([2H])c([2H])nc12 |
| InChI | InChI=1S/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D |
| InChIKey | DGEZNRSVGBDHLK-GSNKEKJESA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|