C52H32N2S — CID 166508968
2,3,4,5,6,7,8-heptadeuterio-9-[4-[3-[5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 166508968) has the molecular formula C52H32N2S and a molecular weight of 723.95 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-9-[4-[3-[5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-9-[4-[3-[5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166508968 |
| Molecular Formula | C52H32N2S |
| Molecular Weight | 723.95 g/mol |
| Exact Mass | 723.27 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-9-[4-[3-[5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1nc2c(c([2H])c1[2H])c([2H])c([2H])c1c([2H])c([2H])c(-c3ccc(-c4cccc(-c5ccc(-c6c7ccccc7c(-c7ccccc7)c7ccccc67)s5)c4)c4ccccc34)nc12 |
| InChI | InChI=1S/C52H32N2S/c1-2-12-33(13-3-1)49-42-19-6-8-21-44(42)50(45-22-9-7-20-43(45)49)48-30-29-47(55-48)37-15-10-14-36(32-37)38-26-27-41(40-18-5-4-17-39(38)40)46-28-25-35-24-23-34-16-11-31-53-51(34)52(35)54-46/h1-32H/i11D,16D,23D,24D,25D,28D,31D |
| InChIKey | MTFAWIKSUQJAMN-DSFQCDOMSA-N |
| XLogP | 14.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.95 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|