C46H28N4 — CID 162506940
2,3,4,5,6,7,8-heptadeuterio-9-[2,3,5,6,7,8-hexadeuterio-4-[10-(4-pyrimidin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 162506940) has the molecular formula C46H28N4 and a molecular weight of 649.84 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-9-[2,3,5,6,7,8-hexadeuterio-4-[10-(4-pyrimidin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-9-[2,3,5,6,7,8-hexadeuterio-4-[10-(4-pyrimidin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 162506940 |
| Molecular Formula | C46H28N4 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.31 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-9-[2,3,5,6,7,8-hexadeuterio-4-[10-(4-pyrimidin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1nc2c(c([2H])c1[2H])c([2H])c([2H])c1c([2H])c([2H])c(-c3c([2H])c([2H])c(-c4c5ccccc5c(-c5ccc(-c6ncccn6)cc5)c5ccccc45)c4c([2H])c([2H])c([2H])c([2H])c34)nc12 |
| InChI | InChI=1S/C46H28N4/c1-2-11-34-33(10-1)35(41-25-22-31-19-18-30-9-7-26-47-44(30)45(31)50-41)23-24-40(34)43-38-14-5-3-12-36(38)42(37-13-4-6-15-39(37)43)29-16-20-32(21-17-29)46-48-27-8-28-49-46/h1-28H/i1D,2D,7D,9D,10D,11D,18D,19D,22D,23D,24D,25D,26D |
| InChIKey | JLKNUUPQUMASDL-QVHIJMDISA-N |
| XLogP | 11.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|