C64H40N2S — CID 166508820
2-[2,3,5,6,7,8-hexadeuterio-4-[4-[3,4-diphenyl-5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 166508820) has the molecular formula C64H40N2S and a molecular weight of 875.14 g/mol. Its IUPAC name is 2-[2,3,5,6,7,8-hexadeuterio-4-[4-[3,4-diphenyl-5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[2,3,5,6,7,8-hexadeuterio-4-[4-[3,4-diphenyl-5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166508820 |
| Molecular Formula | C64H40N2S |
| Molecular Weight | 875.14 g/mol |
| Exact Mass | 874.33 |
| IUPAC Name | 2-[2,3,5,6,7,8-hexadeuterio-4-[4-[3,4-diphenyl-5-(10-phenylanthracen-9-yl)thiophen-2-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccc5cccnc5c4n3)c([2H])c([2H])c(-c3ccc(-c4sc(-c5c6ccccc6c(-c6ccccc6)c6ccccc56)c(-c5ccccc5)c4-c4ccccc4)cc3)c2c1[2H] |
| InChI | InChI=1S/C64H40N2S/c1-4-17-42(18-5-1)57-52-26-12-14-28-54(52)60(55-29-15-13-27-53(55)57)64-59(44-21-8-3-9-22-44)58(43-19-6-2-7-20-43)63(67-64)47-34-30-41(31-35-47)48-37-38-51(50-25-11-10-24-49(48)50)56-39-36-46-33-32-45-23-16-40-65-61(45)62(46)66-56/h1-40H/i10D,11D,24D,25D,37D,38D |
| InChIKey | BVPFGCQHEVFREN-YBLJTJINSA-N |
| XLogP | 17.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.14 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|