C64H40N2O — CID 166508855
2-[2,3,5,6,7,8-hexadeuterio-4-[3-[2,4-diphenyl-5-(10-phenylanthracen-9-yl)furan-3-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 166508855) has the molecular formula C64H40N2O and a molecular weight of 859.07 g/mol. Its IUPAC name is 2-[2,3,5,6,7,8-hexadeuterio-4-[3-[2,4-diphenyl-5-(10-phenylanthracen-9-yl)furan-3-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[2,3,5,6,7,8-hexadeuterio-4-[3-[2,4-diphenyl-5-(10-phenylanthracen-9-yl)furan-3-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166508855 |
| Molecular Formula | C64H40N2O |
| Molecular Weight | 859.07 g/mol |
| Exact Mass | 858.35 |
| IUPAC Name | 2-[2,3,5,6,7,8-hexadeuterio-4-[3-[2,4-diphenyl-5-(10-phenylanthracen-9-yl)furan-3-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccc5cccnc5c4n3)c([2H])c([2H])c(-c3cccc(-c4c(-c5ccccc5)oc(-c5c6ccccc6c(-c6ccccc6)c6ccccc56)c4-c4ccccc4)c3)c2c1[2H] |
| InChI | InChI=1S/C64H40N2O/c1-4-18-41(19-5-1)57-52-29-12-14-31-54(52)60(55-32-15-13-30-53(55)57)64-58(42-20-6-2-7-21-42)59(63(67-64)45-22-8-3-9-23-45)47-25-16-24-46(40-47)48-36-37-51(50-28-11-10-27-49(48)50)56-38-35-44-34-33-43-26-17-39-65-61(43)62(44)66-56/h1-40H/i10D,11D,27D,28D,36D,37D |
| InChIKey | BJCPKALKHXCYJQ-LJNDNZDPSA-N |
| XLogP | 17.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.07 |
| LogP ≤ 5 | 17.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|