C60H36N2S — CID 166508979
2-[2,3,5,6,7,8-hexadeuterio-4-[4-(2,4-diphenyl-5-pyren-1-ylthiophen-3-yl)phenyl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 166508979) has the molecular formula C60H36N2S and a molecular weight of 823.07 g/mol. Its IUPAC name is 2-[2,3,5,6,7,8-hexadeuterio-4-[4-(2,4-diphenyl-5-pyren-1-ylthiophen-3-yl)phenyl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[2,3,5,6,7,8-hexadeuterio-4-[4-(2,4-diphenyl-5-pyren-1-ylthiophen-3-yl)phenyl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166508979 |
| Molecular Formula | C60H36N2S |
| Molecular Weight | 823.07 g/mol |
| Exact Mass | 822.30 |
| IUPAC Name | 2-[2,3,5,6,7,8-hexadeuterio-4-[4-(2,4-diphenyl-5-pyren-1-ylthiophen-3-yl)phenyl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccc5cccnc5c4n3)c([2H])c([2H])c(-c3ccc(-c4c(-c5ccccc5)sc(-c5ccc6ccc7cccc8ccc5c6c78)c4-c4ccccc4)cc3)c2c1[2H] |
| InChI | InChI=1S/C60H36N2S/c1-3-11-38(12-4-1)56-55(59(45-13-5-2-6-14-45)63-60(56)51-32-29-41-25-24-39-15-9-16-40-28-31-50(51)54(41)53(39)40)42-22-20-37(21-23-42)46-33-34-49(48-19-8-7-18-47(46)48)52-35-30-44-27-26-43-17-10-36-61-57(43)58(44)62-52/h1-36H/i7D,8D,18D,19D,33D,34D |
| InChIKey | BPJJTJYUDFXYOQ-ZPIBLJSBSA-N |
| XLogP | 16.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.07 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|