C12H12 — CID 54237311
1,2,3,4,5,6-hexadeuterio-7,8-bis(trideuteriomethyl)naphthalene (PubChem CID 54237311) has the molecular formula C12H12 and a molecular weight of 168.30 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexadeuterio-7,8-bis(trideuteriomethyl)naphthalene.
| Compound Name | 1,2,3,4,5,6-hexadeuterio-7,8-bis(trideuteriomethyl)naphthalene |
|---|---|
| PubChem CID | 54237311 |
| Molecular Formula | C12H12 |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.17 |
| IUPAC Name | 1,2,3,4,5,6-hexadeuterio-7,8-bis(trideuteriomethyl)naphthalene |
| SMILES | [2H]c1c([2H])c([2H])c2c(C([2H])([2H])[2H])c(C([2H])([2H])[2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C12H12/c1-9-7-8-11-5-3-4-6-12(11)10(9)2/h3-8H,1-2H3/i1D3,2D3,3D,4D,5D,6D,7D,8D |
| InChIKey | QNLZIZAQLLYXTC-CLWNCLMISA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |