C18H11ClN2 — CID 122524424
2-chloro-5,6,7,8,9,10-hexadeuterio-4-phenylbenzo[h]quinazoline (PubChem CID 122524424) has the molecular formula C18H11ClN2 and a molecular weight of 296.79 g/mol. Its IUPAC name is 2-chloro-5,6,7,8,9,10-hexadeuterio-4-phenylbenzo[h]quinazoline.
| Compound Name | 2-chloro-5,6,7,8,9,10-hexadeuterio-4-phenylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 122524424 |
| Molecular Formula | C18H11ClN2 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-chloro-5,6,7,8,9,10-hexadeuterio-4-phenylbenzo[h]quinazoline |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c(-c3ccccc3)nc(Cl)nc12 |
| InChI | InChI=1S/C18H11ClN2/c19-18-20-16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)21-18/h1-11H/i4D,5D,6D,9D,10D,11D |
| InChIKey | HGPVPXXVBLDHPA-VVMJSCDLSA-N |
| XLogP | 5.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|