C14H9ClN2 — CID 168832653
2-chloro-5,6,7,8-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)quinazoline (PubChem CID 168832653) has the molecular formula C14H9ClN2 and a molecular weight of 249.75 g/mol. Its IUPAC name is 2-chloro-5,6,7,8-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)quinazoline.
| Compound Name | 2-chloro-5,6,7,8-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)quinazoline |
|---|---|
| PubChem CID | 168832653 |
| Molecular Formula | C14H9ClN2 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-chloro-5,6,7,8-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)quinazoline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(Cl)nc3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C14H9ClN2/c15-14-16-12-9-5-4-8-11(12)13(17-14)10-6-2-1-3-7-10/h1-9H/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| InChIKey | SFKMVPQJJGJCMI-LOIXRAQWSA-N |
| XLogP | 3.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |