C24H15ClN2 — CID 122524422
2-chloro-5,6,7,8,9,10-hexadeuterio-4-(4-phenylphenyl)benzo[h]quinazoline (PubChem CID 122524422) has the molecular formula C24H15ClN2 and a molecular weight of 372.89 g/mol. Its IUPAC name is 2-chloro-5,6,7,8,9,10-hexadeuterio-4-(4-phenylphenyl)benzo[h]quinazoline.
| Compound Name | 2-chloro-5,6,7,8,9,10-hexadeuterio-4-(4-phenylphenyl)benzo[h]quinazoline |
|---|---|
| PubChem CID | 122524422 |
| Molecular Formula | C24H15ClN2 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-chloro-5,6,7,8,9,10-hexadeuterio-4-(4-phenylphenyl)benzo[h]quinazoline |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c(-c3ccc(-c4ccccc4)cc3)nc(Cl)nc12 |
| InChI | InChI=1S/C24H15ClN2/c25-24-26-22(19-12-10-17(11-13-19)16-6-2-1-3-7-16)21-15-14-18-8-4-5-9-20(18)23(21)27-24/h1-15H/i4D,5D,8D,9D,14D,15D |
| InChIKey | NGBPLPWSBUBLRY-XMXPPHHLSA-N |
| XLogP | 6.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|