C31H20ClN3 — CID 171731271
2-chloro-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-1,3,5-triazine (PubChem CID 171731271) has the molecular formula C31H20ClN3 and a molecular weight of 481.04 g/mol. Its IUPAC name is 2-chloro-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171731271 |
| Molecular Formula | C31H20ClN3 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-chloro-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c3c2[2H])c([2H])c([2H])c1-c1nc(Cl)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C31H20ClN3/c32-31-34-29(25-15-10-23(11-16-25)21-6-2-1-3-7-21)33-30(35-31)26-17-12-24(13-18-26)28-19-14-22-8-4-5-9-27(22)20-28/h1-20H/i4D,5D,8D,9D,12D,13D,14D,17D,18D,19D,20D |
| InChIKey | NRCTYGTUQWABKU-OHGDCHRWSA-N |
| XLogP | 8.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |